C16H7F5N2O2 — CID 170435306
N-(3-cyano-4-fluoro-2-formylphenyl)-3-fluoro-5-(trifluoromethyl)benzamide (PubChem CID 170435306) has the molecular formula C16H7F5N2O2 and a molecular weight of 354.23 g/mol. Its IUPAC name is N-(3-cyano-4-fluoro-2-formylphenyl)-3-fluoro-5-(trifluoromethyl)benzamide.
| Compound Name | N-(3-cyano-4-fluoro-2-formylphenyl)-3-fluoro-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 170435306 |
| Molecular Formula | C16H7F5N2O2 |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 354.04 |
| IUPAC Name | N-(3-cyano-4-fluoro-2-formylphenyl)-3-fluoro-5-(trifluoromethyl)benzamide |
| SMILES | N#Cc1c(F)ccc(NC(=O)c2cc(F)cc(C(F)(F)F)c2)c1C=O |
| InChI | InChI=1S/C16H7F5N2O2/c17-10-4-8(3-9(5-10)16(19,20)21)15(25)23-14-2-1-13(18)11(6-22)12(14)7-24/h1-5,7H,(H,23,25) |
| InChIKey | ZCLZPTBLABNQQS-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|