C24H20F4N6O2 — CID 167512132
N-[(Z)-1,3-diaminoprop-2-enylidene]-5-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-6-(2-methylanilino)pyridine-3-carboxamide (PubChem CID 167512132) has the molecular formula C24H20F4N6O2 and a molecular weight of 500.46 g/mol. Its IUPAC name is N-[(Z)-1,3-diaminoprop-2-enylidene]-5-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-6-(2-methylanilino)pyridine-3-carboxamide.
| Compound Name | N-[(Z)-1,3-diaminoprop-2-enylidene]-5-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-6-(2-methylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167512132 |
| Molecular Formula | C24H20F4N6O2 |
| Molecular Weight | 500.46 g/mol |
| Exact Mass | 500.16 |
| IUPAC Name | N-[(Z)-1,3-diaminoprop-2-enylidene]-5-[[3-fluoro-5-(trifluoromethyl)benzoyl]amino]-6-(2-methylanilino)pyridine-3-carboxamide |
| SMILES | Cc1ccccc1Nc1ncc(C(=O)/N=C(N)/C=C\N)cc1NC(=O)c1cc(F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H20F4N6O2/c1-13-4-2-3-5-18(13)32-21-19(10-15(12-31-21)23(36)34-20(30)6-7-29)33-22(35)14-8-16(24(26,27)28)11-17(25)9-14/h2-12H,29H2,1H3,(H,31,32)(H,33,35)(H2,30,34,36)/b7-6- |
| InChIKey | RRBOMGVZVDVNLE-SREVYHEPSA-N |
| XLogP | 4.51 |
| TPSA | 135.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.46 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|