C22H36N4O — CID 167512450
ethane;6-(2-methylanilino)-5-(prop-1-en-2-ylamino)pyridine-3-carboxamide (PubChem CID 167512450) has the molecular formula C22H36N4O and a molecular weight of 372.56 g/mol. Its IUPAC name is ethane;6-(2-methylanilino)-5-(prop-1-en-2-ylamino)pyridine-3-carboxamide.
| Compound Name | ethane;6-(2-methylanilino)-5-(prop-1-en-2-ylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167512450 |
| Molecular Formula | C22H36N4O |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.29 |
| IUPAC Name | ethane;6-(2-methylanilino)-5-(prop-1-en-2-ylamino)pyridine-3-carboxamide |
| SMILES | C=C(C)Nc1cc(C(N)=O)cnc1Nc1ccccc1C.CC.CC.CC |
| InChI | InChI=1S/C16H18N4O.3C2H6/c1-10(2)19-14-8-12(15(17)21)9-18-16(14)20-13-7-5-4-6-11(13)3;3*1-2/h4-9,19H,1H2,2-3H3,(H2,17,21)(H,18,20);3*1-2H3 |
| InChIKey | OBKOYAKMVRBUMR-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |