C23H25FN6O2 — CID 167512347
5-[[2-ethenyl-4-fluoro-3-[(Z)-prop-1-enyl]-1,2-dihydroimidazole-5-carbonyl]amino]-N-methyl-6-(2-methylanilino)pyridine-3-carboxamide (PubChem CID 167512347) has the molecular formula C23H25FN6O2 and a molecular weight of 436.49 g/mol. Its IUPAC name is 5-[[2-ethenyl-4-fluoro-3-[(Z)-prop-1-enyl]-1,2-dihydroimidazole-5-carbonyl]amino]-N-methyl-6-(2-methylanilino)pyridine-3-carboxamide.
| Compound Name | 5-[[2-ethenyl-4-fluoro-3-[(Z)-prop-1-enyl]-1,2-dihydroimidazole-5-carbonyl]amino]-N-methyl-6-(2-methylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 167512347 |
| Molecular Formula | C23H25FN6O2 |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 5-[[2-ethenyl-4-fluoro-3-[(Z)-prop-1-enyl]-1,2-dihydroimidazole-5-carbonyl]amino]-N-methyl-6-(2-methylanilino)pyridine-3-carboxamide |
| SMILES | C=CC1NC(C(=O)Nc2cc(C(=O)NC)cnc2Nc2ccccc2C)=C(F)N1/C=C\C |
| InChI | InChI=1S/C23H25FN6O2/c1-5-11-30-18(6-2)29-19(20(30)24)23(32)28-17-12-15(22(31)25-4)13-26-21(17)27-16-10-8-7-9-14(16)3/h5-13,18,29H,2H2,1,3-4H3,(H,25,31)(H,26,27)(H,28,32)/b11-5- |
| InChIKey | OPTTVRLZWFXTFQ-WZUFQYTHSA-N |
| XLogP | 3.52 |
| TPSA | 98.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|