C18H17NO3 — CID 167513393
methyl 2-(6-methoxy-2-azatetracyclo[8.5.0.01,11.04,9]pentadeca-2,4(9),5,7,12,14-hexaen-14-yl)acetate (PubChem CID 167513393) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is methyl 2-(6-methoxy-2-azatetracyclo[8.5.0.01,11.04,9]pentadeca-2,4(9),5,7,12,14-hexaen-14-yl)acetate.
| Compound Name | methyl 2-(6-methoxy-2-azatetracyclo[8.5.0.01,11.04,9]pentadeca-2,4(9),5,7,12,14-hexaen-14-yl)acetate |
|---|---|
| PubChem CID | 167513393 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | methyl 2-(6-methoxy-2-azatetracyclo[8.5.0.01,11.04,9]pentadeca-2,4(9),5,7,12,14-hexaen-14-yl)acetate |
| SMILES | COC(=O)CC1=CC23N=Cc4cc(OC)ccc4C2C3C=C1 |
| InChI | InChI=1S/C18H17NO3/c1-21-13-4-5-14-12(8-13)10-19-18-9-11(7-16(20)22-2)3-6-15(18)17(14)18/h3-6,8-10,15,17H,7H2,1-2H3 |
| InChIKey | GVVXYTVVTYNILI-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |