C22H35N3O5 — CID 16751773
N-(8-benzamidooctyl)-N'-(1,3-dihydroxypropan-2-yl)butanediamide (PubChem CID 16751773) has the molecular formula C22H35N3O5 and a molecular weight of 421.54 g/mol. Its IUPAC name is N-(8-benzamidooctyl)-N'-(1,3-dihydroxypropan-2-yl)butanediamide.
| Compound Name | N-(8-benzamidooctyl)-N'-(1,3-dihydroxypropan-2-yl)butanediamide |
|---|---|
| PubChem CID | 16751773 |
| Molecular Formula | C22H35N3O5 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | N-(8-benzamidooctyl)-N'-(1,3-dihydroxypropan-2-yl)butanediamide |
| SMILES | O=C(CCC(=O)NC(CO)CO)NCCCCCCCCNC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H35N3O5/c26-16-19(17-27)25-21(29)13-12-20(28)23-14-8-3-1-2-4-9-15-24-22(30)18-10-6-5-7-11-18/h5-7,10-11,19,26-27H,1-4,8-9,12-17H2,(H,23,28)(H,24,30)(H,25,29) |
| InChIKey | IGZYMOQGRIQJGZ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|