C25H20N2O3 — CID 16751800
4-[4-(4-methylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one (PubChem CID 16751800) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 4-[4-(4-methylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one.
| Compound Name | 4-[4-(4-methylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one |
|---|---|
| PubChem CID | 16751800 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | 4-[4-(4-methylphenoxy)but-2-ynoxy]-1-phenyl-1,8-naphthyridin-2-one |
| SMILES | Cc1ccc(OCC#CCOc2cc(=O)n(-c3ccccc3)c3ncccc23)cc1 |
| InChI | InChI=1S/C25H20N2O3/c1-19-11-13-21(14-12-19)29-16-5-6-17-30-23-18-24(28)27(20-8-3-2-4-9-20)25-22(23)10-7-15-26-25/h2-4,7-15,18H,16-17H2,1H3 |
| InChIKey | BNJWFJFQMJDQEN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|