C18H11F2N5O4 — CID 167518296
[4-(5-fluoro-3-pyridinyl)-6-[5-(5-fluoro-2-pyridinyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methanetriol (PubChem CID 167518296) has the molecular formula C18H11F2N5O4 and a molecular weight of 399.31 g/mol. Its IUPAC name is [4-(5-fluoro-3-pyridinyl)-6-[5-(5-fluoro-2-pyridinyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methanetriol.
| Compound Name | [4-(5-fluoro-3-pyridinyl)-6-[5-(5-fluoro-2-pyridinyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methanetriol |
|---|---|
| PubChem CID | 167518296 |
| Molecular Formula | C18H11F2N5O4 |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | [4-(5-fluoro-3-pyridinyl)-6-[5-(5-fluoro-2-pyridinyl)-1,3,4-oxadiazol-2-yl]-2-pyridinyl]methanetriol |
| SMILES | OC(O)(O)c1cc(-c2cncc(F)c2)cc(-c2nnc(-c3ccc(F)cn3)o2)n1 |
| InChI | InChI=1S/C18H11F2N5O4/c19-11-1-2-13(22-8-11)16-24-25-17(29-16)14-4-9(5-15(23-14)18(26,27)28)10-3-12(20)7-21-6-10/h1-8,26-28H |
| InChIKey | GLJNSXFSTLFYDW-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 138.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|