C25H29ClF3N5O4 — CID 167521389
(2S)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-1-(3-methoxypropanoyl)-3,4,4-trimethylpyrrolidine-2-carboxamide;2,2,2-trifluoroacetamide (PubChem CID 167521389) has the molecular formula C25H29ClF3N5O4 and a molecular weight of 555.99 g/mol. Its IUPAC name is (2S)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-1-(3-methoxypropanoyl)-3,4,4-trimethylpyrrolidine-2-carboxamide;2,2,2-trifluoroacetamide.
| Compound Name | (2S)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-1-(3-methoxypropanoyl)-3,4,4-trimethylpyrrolidine-2-carboxamide;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167521389 |
| Molecular Formula | C25H29ClF3N5O4 |
| Molecular Weight | 555.99 g/mol |
| Exact Mass | 555.19 |
| IUPAC Name | (2S)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-1-(3-methoxypropanoyl)-3,4,4-trimethylpyrrolidine-2-carboxamide;2,2,2-trifluoroacetamide |
| SMILES | COCCC(=O)N1CC(C)(C)C(C)[C@H]1C(=O)NC(C#N)c1cncc2cccc(Cl)c12.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C23H27ClN4O3.C2H2F3NO/c1-14-21(28(13-23(14,2)3)19(29)8-9-31-4)22(30)27-18(10-25)16-12-26-11-15-6-5-7-17(24)20(15)16;3-2(4,5)1(6)7/h5-7,11-12,14,18,21H,8-9,13H2,1-4H3,(H,27,30);(H2,6,7)/t14?,18?,21-;/m0./s1 |
| InChIKey | SCXMLYXNVWMADG-LJYJDYPDSA-N |
| XLogP | 3.51 |
| TPSA | 138.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.99 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |