C27H31ClF3N5O3 — CID 167521891
(2S,3R)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-3,4,4-trimethyl-1-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]pyrrolidine-2-carboxamide;methylcyclopropane (PubChem CID 167521891) has the molecular formula C27H31ClF3N5O3 and a molecular weight of 566.02 g/mol. Its IUPAC name is (2S,3R)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-3,4,4-trimethyl-1-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]pyrrolidine-2-carboxamide;methylcyclopropane.
| Compound Name | (2S,3R)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-3,4,4-trimethyl-1-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]pyrrolidine-2-carboxamide;methylcyclopropane |
|---|---|
| PubChem CID | 167521891 |
| Molecular Formula | C27H31ClF3N5O3 |
| Molecular Weight | 566.02 g/mol |
| Exact Mass | 565.21 |
| IUPAC Name | (2S,3R)-N-[(5-chloroisoquinolin-4-yl)-cyanomethyl]-3,4,4-trimethyl-1-[2-[(2,2,2-trifluoroacetyl)amino]acetyl]pyrrolidine-2-carboxamide;methylcyclopropane |
| SMILES | CC1CC1.C[C@H]1[C@@H](C(=O)NC(C#N)c2cncc3cccc(Cl)c23)N(C(=O)CNC(=O)C(F)(F)F)CC1(C)C |
| InChI | InChI=1S/C23H23ClF3N5O3.C4H8/c1-12-19(32(11-22(12,2)3)17(33)10-30-21(35)23(25,26)27)20(34)31-16(7-28)14-9-29-8-13-5-4-6-15(24)18(13)14;1-4-2-3-4/h4-6,8-9,12,16,19H,10-11H2,1-3H3,(H,30,35)(H,31,34);4H,2-3H2,1H3/t12-,16?,19-;/m0./s1 |
| InChIKey | MSWJIWBCAFOICO-OIAXANSUSA-N |
| XLogP | 4.54 |
| TPSA | 115.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.02 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |