C24H31F3N6O3 — CID 167521541
N-[1-[[cyano(1,2,3,4-tetrahydrophthalazin-1-yl)methyl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide (PubChem CID 167521541) has the molecular formula C24H31F3N6O3 and a molecular weight of 508.55 g/mol. Its IUPAC name is N-[1-[[cyano(1,2,3,4-tetrahydrophthalazin-1-yl)methyl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide.
| Compound Name | N-[1-[[cyano(1,2,3,4-tetrahydrophthalazin-1-yl)methyl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
|---|---|
| PubChem CID | 167521541 |
| Molecular Formula | C24H31F3N6O3 |
| Molecular Weight | 508.55 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | N-[1-[[cyano(1,2,3,4-tetrahydrophthalazin-1-yl)methyl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-3,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]butanamide |
| SMILES | CC(C)(C)C(NC(=O)C(F)(F)F)C(=O)NC(CC1CC1)C(=O)NC(C#N)C1NNCc2ccccc21 |
| InChI | InChI=1S/C24H31F3N6O3/c1-23(2,3)19(32-22(36)24(25,26)27)21(35)30-16(10-13-8-9-13)20(34)31-17(11-28)18-15-7-5-4-6-14(15)12-29-33-18/h4-7,13,16-19,29,33H,8-10,12H2,1-3H3,(H,30,35)(H,31,34)(H,32,36) |
| InChIKey | XVFIVGGRFDJJBT-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 135.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.55 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |