C11H21N — CID 167522004
(7R)-2,2,6,7-tetramethyl-6-azaspiro[3.4]octane (PubChem CID 167522004) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is (7R)-2,2,6,7-tetramethyl-6-azaspiro[3.4]octane.
| Compound Name | (7R)-2,2,6,7-tetramethyl-6-azaspiro[3.4]octane |
|---|---|
| PubChem CID | 167522004 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | (7R)-2,2,6,7-tetramethyl-6-azaspiro[3.4]octane |
| SMILES | C[C@@H]1CC2(CN1C)CC(C)(C)C2 |
| InChI | InChI=1S/C11H21N/c1-9-5-11(8-12(9)4)6-10(2,3)7-11/h9H,5-8H2,1-4H3/t9-/m1/s1 |
| InChIKey | QINLVBKKAMNKAP-SECBINFHSA-N |
| XLogP | 2.52 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |