C23H37F3N4O3 — CID 167522213
N-(1-cyano-3-methylpent-4-enyl)formamide;methylcyclopropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide (PubChem CID 167522213) has the molecular formula C23H37F3N4O3 and a molecular weight of 474.57 g/mol. Its IUPAC name is N-(1-cyano-3-methylpent-4-enyl)formamide;methylcyclopropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide.
| Compound Name | N-(1-cyano-3-methylpent-4-enyl)formamide;methylcyclopropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 167522213 |
| Molecular Formula | C23H37F3N4O3 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.28 |
| IUPAC Name | N-(1-cyano-3-methylpent-4-enyl)formamide;methylcyclopropane;2,2,2-trifluoro-N-[2-oxo-2-[(4R)-3,3,4-trimethylpyrrolidin-1-yl]ethyl]acetamide |
| SMILES | C=CC(C)CC(C#N)NC=O.CC1CC1.C[C@H]1CN(C(=O)CNC(=O)C(F)(F)F)CC1(C)C |
| InChI | InChI=1S/C11H17F3N2O2.C8H12N2O.C4H8/c1-7-5-16(6-10(7,2)3)8(17)4-15-9(18)11(12,13)14;1-3-7(2)4-8(5-9)10-6-11;1-4-2-3-4/h7H,4-6H2,1-3H3,(H,15,18);3,6-8H,1,4H2,2H3,(H,10,11);4H,2-3H2,1H3/t7-;;/m0../s1 |
| InChIKey | XGSYRVHIUSHOFF-KLXURFKVSA-N |
| XLogP | 3.42 |
| TPSA | 102.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|