C21H35F3N4O3 — CID 167522613
N-(1-cyanobut-3-enyl)formamide;3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide (PubChem CID 167522613) has the molecular formula C21H35F3N4O3 and a molecular weight of 448.53 g/mol. Its IUPAC name is N-(1-cyanobut-3-enyl)formamide;3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide.
| Compound Name | N-(1-cyanobut-3-enyl)formamide;3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167522613 |
| Molecular Formula | C21H35F3N4O3 |
| Molecular Weight | 448.53 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | N-(1-cyanobut-3-enyl)formamide;3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide |
| SMILES | C=CCC(C#N)NC=O.CC1CN(C(=O)CC(C)(C)C)CC1(C)C.NC(=O)C(F)(F)F |
| InChI | InChI=1S/C13H25NO.C6H8N2O.C2H2F3NO/c1-10-8-14(9-13(10,5)6)11(15)7-12(2,3)4;1-2-3-6(4-7)8-5-9;3-2(4,5)1(6)7/h10H,7-9H2,1-6H3;2,5-6H,1,3H2,(H,8,9);(H2,6,7) |
| InChIKey | GJMWQRHIRPGIPH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 116.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.53 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|