C15H29NO3 — CID 170632062
3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;methyl formate (PubChem CID 170632062) has the molecular formula C15H29NO3 and a molecular weight of 271.40 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;methyl formate.
| Compound Name | 3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;methyl formate |
|---|---|
| PubChem CID | 170632062 |
| Molecular Formula | C15H29NO3 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.21 |
| IUPAC Name | 3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;methyl formate |
| SMILES | CC1CN(C(=O)CC(C)(C)C)CC1(C)C.COC=O |
| InChI | InChI=1S/C13H25NO.C2H4O2/c1-10-8-14(9-13(10,5)6)11(15)7-12(2,3)4;1-4-2-3/h10H,7-9H2,1-6H3;2H,1H3 |
| InChIKey | UOHQELOWWFNBIX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|