C13H22F3NO3 — CID 176706808
3,3-dimethyl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;methyl formate (PubChem CID 176706808) has the molecular formula C13H22F3NO3 and a molecular weight of 297.32 g/mol. Its IUPAC name is 3,3-dimethyl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;methyl formate.
| Compound Name | 3,3-dimethyl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;methyl formate |
|---|---|
| PubChem CID | 176706808 |
| Molecular Formula | C13H22F3NO3 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 3,3-dimethyl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;methyl formate |
| SMILES | CC(C)(C)CC(=O)N1CCC(C(F)(F)F)C1.COC=O |
| InChI | InChI=1S/C11H18F3NO.C2H4O2/c1-10(2,3)6-9(16)15-5-4-8(7-15)11(12,13)14;1-4-2-3/h8H,4-7H2,1-3H3;2H,1H3 |
| InChIKey | YDAZUDIGRPQLHL-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|