C14H25F3N2O5 — CID 176706804
3,3-dimethyl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate (PubChem CID 176706804) has the molecular formula C14H25F3N2O5 and a molecular weight of 358.36 g/mol. Its IUPAC name is 3,3-dimethyl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate.
| Compound Name | 3,3-dimethyl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate |
|---|---|
| PubChem CID | 176706804 |
| Molecular Formula | C14H25F3N2O5 |
| Molecular Weight | 358.36 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | 3,3-dimethyl-1-[3-(trifluoromethyl)pyrrolidin-1-yl]butan-1-one;formic acid;methyl carbamate |
| SMILES | CC(C)(C)CC(=O)N1CCC(C(F)(F)F)C1.COC(N)=O.O=CO |
| InChI | InChI=1S/C11H18F3NO.C2H5NO2.CH2O2/c1-10(2,3)6-9(16)15-5-4-8(7-15)11(12,13)14;1-5-2(3)4;2-1-3/h8H,4-7H2,1-3H3;1H3,(H2,3,4);1H,(H,2,3) |
| InChIKey | IZKIMSYZCPWGHK-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.36 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|