C16H29F3N2O4 — CID 170632494
3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;formic acid;2,2,2-trifluoroacetamide (PubChem CID 170632494) has the molecular formula C16H29F3N2O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;formic acid;2,2,2-trifluoroacetamide.
| Compound Name | 3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;formic acid;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 170632494 |
| Molecular Formula | C16H29F3N2O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | 3,3-dimethyl-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;formic acid;2,2,2-trifluoroacetamide |
| SMILES | CC1CN(C(=O)CC(C)(C)C)CC1(C)C.NC(=O)C(F)(F)F.O=CO |
| InChI | InChI=1S/C13H25NO.C2H2F3NO.CH2O2/c1-10-8-14(9-13(10,5)6)11(15)7-12(2,3)4;3-2(4,5)1(6)7;2-1-3/h10H,7-9H2,1-6H3;(H2,6,7);1H,(H,2,3) |
| InChIKey | RXVIVNFVMWBYQE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|