C15H27F3N2O5 — CID 167521548
formic acid;(3R)-3-methoxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide (PubChem CID 167521548) has the molecular formula C15H27F3N2O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is formic acid;(3R)-3-methoxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide.
| Compound Name | formic acid;(3R)-3-methoxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 167521548 |
| Molecular Formula | C15H27F3N2O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | formic acid;(3R)-3-methoxy-1-(3,3,4-trimethylpyrrolidin-1-yl)butan-1-one;2,2,2-trifluoroacetamide |
| SMILES | CO[C@H](C)CC(=O)N1CC(C)C(C)(C)C1.NC(=O)C(F)(F)F.O=CO |
| InChI | InChI=1S/C12H23NO2.C2H2F3NO.CH2O2/c1-9-7-13(8-12(9,3)4)11(14)6-10(2)15-5;3-2(4,5)1(6)7;2-1-3/h9-10H,6-8H2,1-5H3;(H2,6,7);1H,(H,2,3)/t9?,10-;;/m1../s1 |
| InChIKey | NPTMOFOHWOKNDR-RBWXRWSZSA-N |
| XLogP | 1.65 |
| TPSA | 109.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|