C14H27NO3 — CID 171088027
3,3-dimethyl-1-[(4S)-3,3,4-trimethylpyrrolidin-1-yl]butan-1-one;formic acid (PubChem CID 171088027) has the molecular formula C14H27NO3 and a molecular weight of 257.37 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(4S)-3,3,4-trimethylpyrrolidin-1-yl]butan-1-one;formic acid.
| Compound Name | 3,3-dimethyl-1-[(4S)-3,3,4-trimethylpyrrolidin-1-yl]butan-1-one;formic acid |
|---|---|
| PubChem CID | 171088027 |
| Molecular Formula | C14H27NO3 |
| Molecular Weight | 257.37 g/mol |
| Exact Mass | 257.20 |
| IUPAC Name | 3,3-dimethyl-1-[(4S)-3,3,4-trimethylpyrrolidin-1-yl]butan-1-one;formic acid |
| SMILES | C[C@@H]1CN(C(=O)CC(C)(C)C)CC1(C)C.O=CO |
| InChI | InChI=1S/C13H25NO.CH2O2/c1-10-8-14(9-13(10,5)6)11(15)7-12(2,3)4;2-1-3/h10H,7-9H2,1-6H3;1H,(H,2,3)/t10-;/m1./s1 |
| InChIKey | JXGBTFAEMFSXKI-HNCPQSOCSA-N |
| XLogP | 2.63 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.37 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|