C12H16F3N3O3 — CID 167524381
[5-[[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]amino]oxan-2-yl]methanol (PubChem CID 167524381) has the molecular formula C12H16F3N3O3 and a molecular weight of 307.27 g/mol. Its IUPAC name is [5-[[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]amino]oxan-2-yl]methanol.
| Compound Name | [5-[[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]amino]oxan-2-yl]methanol |
|---|---|
| PubChem CID | 167524381 |
| Molecular Formula | C12H16F3N3O3 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | [5-[[4-methoxy-6-(trifluoromethyl)pyrimidin-2-yl]amino]oxan-2-yl]methanol |
| SMILES | COc1cc(C(F)(F)F)nc(NC2CCC(CO)OC2)n1 |
| InChI | InChI=1S/C12H16F3N3O3/c1-20-10-4-9(12(13,14)15)17-11(18-10)16-7-2-3-8(5-19)21-6-7/h4,7-8,19H,2-3,5-6H2,1H3,(H,16,17,18) |
| InChIKey | AOHDKOHCCQLZML-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |