C17H24F3N3O9 — CID 171558847
2-[2-[2-[2-[[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetic acid (PubChem CID 171558847) has the molecular formula C17H24F3N3O9 and a molecular weight of 471.39 g/mol. Its IUPAC name is 2-[2-[2-[2-[[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetic acid.
| Compound Name | 2-[2-[2-[2-[[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetic acid |
|---|---|
| PubChem CID | 171558847 |
| Molecular Formula | C17H24F3N3O9 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | 2-[2-[2-[2-[[(3S,4R,5R,6R)-4,5-dihydroxy-6-(hydroxymethyl)oxan-3-yl]amino]-6-(trifluoromethyl)pyrimidin-4-yl]oxyethoxy]ethoxy]acetic acid |
| SMILES | O=C(O)COCCOCCOc1cc(C(F)(F)F)nc(N[C@H]2CO[C@H](CO)[C@H](O)[C@@H]2O)n1 |
| InChI | InChI=1S/C17H24F3N3O9/c18-17(19,20)11-5-12(31-4-3-29-1-2-30-8-13(25)26)23-16(22-11)21-9-7-32-10(6-24)15(28)14(9)27/h5,9-10,14-15,24,27-28H,1-4,6-8H2,(H,25,26)(H,21,22,23)/t9-,10+,14+,15-/m0/s1 |
| InChIKey | OTELGCOLMXOQNG-RZCHIYRCSA-N |
| XLogP | -1.11 |
| TPSA | 172.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|