C21H23N3O3 — CID 167524421
tert-butyl 3-[(E)-3-(5-methyl-2-pyridinyl)prop-2-enyl]-2-oxobenzimidazole-1-carboxylate (PubChem CID 167524421) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is tert-butyl 3-[(E)-3-(5-methyl-2-pyridinyl)prop-2-enyl]-2-oxobenzimidazole-1-carboxylate.
| Compound Name | tert-butyl 3-[(E)-3-(5-methyl-2-pyridinyl)prop-2-enyl]-2-oxobenzimidazole-1-carboxylate |
|---|---|
| PubChem CID | 167524421 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | tert-butyl 3-[(E)-3-(5-methyl-2-pyridinyl)prop-2-enyl]-2-oxobenzimidazole-1-carboxylate |
| SMILES | Cc1ccc(/C=C/Cn2c(=O)n(C(=O)OC(C)(C)C)c3ccccc32)nc1 |
| InChI | InChI=1S/C21H23N3O3/c1-15-11-12-16(22-14-15)8-7-13-23-17-9-5-6-10-18(17)24(19(23)25)20(26)27-21(2,3)4/h5-12,14H,13H2,1-4H3/b8-7+ |
| InChIKey | SBBSTXIEPHHIFH-BQYQJAHWSA-N |
| XLogP | 4.00 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |