C21H31N3O3 — CID 57066051
tert-butyl N-[6-(2-oxo-3-prop-1-en-2-ylbenzimidazol-1-yl)hexyl]carbamate (PubChem CID 57066051) has the molecular formula C21H31N3O3 and a molecular weight of 373.50 g/mol. Its IUPAC name is tert-butyl N-[6-(2-oxo-3-prop-1-en-2-ylbenzimidazol-1-yl)hexyl]carbamate.
| Compound Name | tert-butyl N-[6-(2-oxo-3-prop-1-en-2-ylbenzimidazol-1-yl)hexyl]carbamate |
|---|---|
| PubChem CID | 57066051 |
| Molecular Formula | C21H31N3O3 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | tert-butyl N-[6-(2-oxo-3-prop-1-en-2-ylbenzimidazol-1-yl)hexyl]carbamate |
| SMILES | C=C(C)n1c(=O)n(CCCCCCNC(=O)OC(C)(C)C)c2ccccc21 |
| InChI | InChI=1S/C21H31N3O3/c1-16(2)24-18-13-9-8-12-17(18)23(20(24)26)15-11-7-6-10-14-22-19(25)27-21(3,4)5/h8-9,12-13H,1,6-7,10-11,14-15H2,2-5H3,(H,22,25) |
| InChIKey | XHIVVIMVGCQFLM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 65.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|