C25H28O6S — CID 167527726
S-[2-[4-(ethoxymethoxy)phenyl]ethyl] (E)-3-[4-(ethoxymethoxy)-1-benzofuran-6-yl]prop-2-enethioate (PubChem CID 167527726) has the molecular formula C25H28O6S and a molecular weight of 456.56 g/mol. Its IUPAC name is S-[2-[4-(ethoxymethoxy)phenyl]ethyl] (E)-3-[4-(ethoxymethoxy)-1-benzofuran-6-yl]prop-2-enethioate.
| Compound Name | S-[2-[4-(ethoxymethoxy)phenyl]ethyl] (E)-3-[4-(ethoxymethoxy)-1-benzofuran-6-yl]prop-2-enethioate |
|---|---|
| PubChem CID | 167527726 |
| Molecular Formula | C25H28O6S |
| Molecular Weight | 456.56 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | S-[2-[4-(ethoxymethoxy)phenyl]ethyl] (E)-3-[4-(ethoxymethoxy)-1-benzofuran-6-yl]prop-2-enethioate |
| SMILES | CCOCOc1ccc(CCSC(=O)/C=C/c2cc(OCOCC)c3ccoc3c2)cc1 |
| InChI | InChI=1S/C25H28O6S/c1-3-27-17-30-21-8-5-19(6-9-21)12-14-32-25(26)10-7-20-15-23-22(11-13-29-23)24(16-20)31-18-28-4-2/h5-11,13,15-16H,3-4,12,14,17-18H2,1-2H3/b10-7+ |
| InChIKey | XBMQSACMKPAYMA-JXMROGBWSA-N |
| XLogP | 5.69 |
| TPSA | 67.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.56 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|