C20H33N4O3+ — CID 167528868
tert-butyl N-[(2S)-1-[4-[(1-methylpiperazin-1-ium-1-yl)methyl]anilino]-1-oxopropan-2-yl]carbamate (PubChem CID 167528868) has the molecular formula C20H33N4O3+ and a molecular weight of 377.51 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[4-[(1-methylpiperazin-1-ium-1-yl)methyl]anilino]-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[4-[(1-methylpiperazin-1-ium-1-yl)methyl]anilino]-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 167528868 |
| Molecular Formula | C20H33N4O3+ |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.25 |
| IUPAC Name | tert-butyl N-[(2S)-1-[4-[(1-methylpiperazin-1-ium-1-yl)methyl]anilino]-1-oxopropan-2-yl]carbamate |
| SMILES | C[C@H](NC(=O)OC(C)(C)C)C(=O)Nc1ccc(C[N+]2(C)CCNCC2)cc1 |
| InChI | InChI=1S/C20H32N4O3/c1-15(22-19(26)27-20(2,3)4)18(25)23-17-8-6-16(7-9-17)14-24(5)12-10-21-11-13-24/h6-9,15,21H,10-14H2,1-5H3,(H-,22,23,25,26)/p+1/t15-/m0/s1 |
| InChIKey | ZMPBPWQOURDVKB-HNNXBMFYSA-O |
| XLogP | 2.09 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|