C23H23N3O4 — CID 167542361
2-[4-[5-[(4-methylphenyl)methoxy]-3-pyridinyl]morpholin-2-yl]pyridine-4-carboxylic acid (PubChem CID 167542361) has the molecular formula C23H23N3O4 and a molecular weight of 405.45 g/mol. Its IUPAC name is 2-[4-[5-[(4-methylphenyl)methoxy]-3-pyridinyl]morpholin-2-yl]pyridine-4-carboxylic acid.
| Compound Name | 2-[4-[5-[(4-methylphenyl)methoxy]-3-pyridinyl]morpholin-2-yl]pyridine-4-carboxylic acid |
|---|---|
| PubChem CID | 167542361 |
| Molecular Formula | C23H23N3O4 |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-[4-[5-[(4-methylphenyl)methoxy]-3-pyridinyl]morpholin-2-yl]pyridine-4-carboxylic acid |
| SMILES | Cc1ccc(COc2cncc(N3CCOC(c4cc(C(=O)O)ccn4)C3)c2)cc1 |
| InChI | InChI=1S/C23H23N3O4/c1-16-2-4-17(5-3-16)15-30-20-11-19(12-24-13-20)26-8-9-29-22(14-26)21-10-18(23(27)28)6-7-25-21/h2-7,10-13,22H,8-9,14-15H2,1H3,(H,27,28) |
| InChIKey | BJAWKEMYUOCIFJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |