C21H21F3N2O5 — CID 151937619
(E)-4-[(3R)-4-[5-[[4-(trifluoromethoxy)phenyl]methoxy]-3-pyridinyl]morpholin-3-yl]but-2-enoic acid (PubChem CID 151937619) has the molecular formula C21H21F3N2O5 and a molecular weight of 438.40 g/mol. Its IUPAC name is (E)-4-[(3R)-4-[5-[[4-(trifluoromethoxy)phenyl]methoxy]-3-pyridinyl]morpholin-3-yl]but-2-enoic acid.
| Compound Name | (E)-4-[(3R)-4-[5-[[4-(trifluoromethoxy)phenyl]methoxy]-3-pyridinyl]morpholin-3-yl]but-2-enoic acid |
|---|---|
| PubChem CID | 151937619 |
| Molecular Formula | C21H21F3N2O5 |
| Molecular Weight | 438.40 g/mol |
| Exact Mass | 438.14 |
| IUPAC Name | (E)-4-[(3R)-4-[5-[[4-(trifluoromethoxy)phenyl]methoxy]-3-pyridinyl]morpholin-3-yl]but-2-enoic acid |
| SMILES | O=C(O)/C=C/C[C@@H]1COCCN1c1cncc(OCc2ccc(OC(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C21H21F3N2O5/c22-21(23,24)31-18-6-4-15(5-7-18)13-30-19-10-17(11-25-12-19)26-8-9-29-14-16(26)2-1-3-20(27)28/h1,3-7,10-12,16H,2,8-9,13-14H2,(H,27,28)/b3-1+/t16-/m1/s1 |
| InChIKey | TTZCOFYKMUIHCR-BCMPFUBYSA-N |
| XLogP | 3.80 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|