C31H50 — CID 167543342
(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R)-4-cycloheptylbut-3-en-2-yl]-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 167543342) has the molecular formula C31H50 and a molecular weight of 422.74 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R)-4-cycloheptylbut-3-en-2-yl]-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R)-4-cycloheptylbut-3-en-2-yl]-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 167543342 |
| Molecular Formula | C31H50 |
| Molecular Weight | 422.74 g/mol |
| Exact Mass | 422.39 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R)-4-cycloheptylbut-3-en-2-yl]-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)/C=C/C5CCCCCC5)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C31H50/c1-22-17-19-30(3)25(21-22)13-14-26-28-16-15-27(31(28,4)20-18-29(26)30)23(2)11-12-24-9-7-5-6-8-10-24/h11-13,22-24,26-29H,5-10,14-21H2,1-4H3/b12-11+/t22-,23+,26-,27+,28-,29-,30-,31+/m0/s1 |
| InChIKey | YLDNKZSTIMKMJI-WSFGLLNMSA-N |
| XLogP | 9.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.74 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|