C34H52 — CID 167549235
(3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R)-4-(1-adamantyl)but-3-en-2-yl]-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene (PubChem CID 167549235) has the molecular formula C34H52 and a molecular weight of 460.79 g/mol. Its IUPAC name is (3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R)-4-(1-adamantyl)but-3-en-2-yl]-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene.
| Compound Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R)-4-(1-adamantyl)but-3-en-2-yl]-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 167549235 |
| Molecular Formula | C34H52 |
| Molecular Weight | 460.79 g/mol |
| Exact Mass | 460.41 |
| IUPAC Name | (3S,8S,9S,10R,13R,14S,17R)-17-[(E,2R)-4-(1-adamantyl)but-3-en-2-yl]-3,10,13-trimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene |
| SMILES | C[C@H]1CC[C@@]2(C)C(=CC[C@H]3[C@@H]4CC[C@H]([C@H](C)/C=C/C56CC7CC(CC(C7)C5)C6)[C@@]4(C)CC[C@@H]32)C1 |
| InChI | InChI=1S/C34H52/c1-22-9-12-32(3)27(15-22)5-6-28-30-8-7-29(33(30,4)13-11-31(28)32)23(2)10-14-34-19-24-16-25(20-34)18-26(17-24)21-34/h5,10,14,22-26,28-31H,6-9,11-13,15-21H2,1-4H3/b14-10+/t22-,23+,24?,25?,26?,28-,29+,30-,31-,32-,33+,34?/m0/s1 |
| InChIKey | NRZCENSDJWENAB-SUQRYQGNSA-N |
| XLogP | 9.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.79 |
| LogP ≤ 5 | 9.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|