C20H15ClO5 — CID 167543844
methyl 4-[3-(8-chloro-4-oxochromen-2-yl)-3-oxopropyl]benzoate (PubChem CID 167543844) has the molecular formula C20H15ClO5 and a molecular weight of 370.79 g/mol. Its IUPAC name is methyl 4-[3-(8-chloro-4-oxochromen-2-yl)-3-oxopropyl]benzoate.
| Compound Name | methyl 4-[3-(8-chloro-4-oxochromen-2-yl)-3-oxopropyl]benzoate |
|---|---|
| PubChem CID | 167543844 |
| Molecular Formula | C20H15ClO5 |
| Molecular Weight | 370.79 g/mol |
| Exact Mass | 370.06 |
| IUPAC Name | methyl 4-[3-(8-chloro-4-oxochromen-2-yl)-3-oxopropyl]benzoate |
| SMILES | COC(=O)c1ccc(CCC(=O)c2cc(=O)c3cccc(Cl)c3o2)cc1 |
| InChI | InChI=1S/C20H15ClO5/c1-25-20(24)13-8-5-12(6-9-13)7-10-16(22)18-11-17(23)14-3-2-4-15(21)19(14)26-18/h2-6,8-9,11H,7,10H2,1H3 |
| InChIKey | BNPYFEPWAWGBQW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.79 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |