C19H13ClO5 — CID 167655294
4-[2-(8-chloro-4-oxochromen-2-yl)-2-oxoethyl]-3-methylbenzoic acid (PubChem CID 167655294) has the molecular formula C19H13ClO5 and a molecular weight of 356.76 g/mol. Its IUPAC name is 4-[2-(8-chloro-4-oxochromen-2-yl)-2-oxoethyl]-3-methylbenzoic acid.
| Compound Name | 4-[2-(8-chloro-4-oxochromen-2-yl)-2-oxoethyl]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 167655294 |
| Molecular Formula | C19H13ClO5 |
| Molecular Weight | 356.76 g/mol |
| Exact Mass | 356.05 |
| IUPAC Name | 4-[2-(8-chloro-4-oxochromen-2-yl)-2-oxoethyl]-3-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)O)ccc1CC(=O)c1cc(=O)c2cccc(Cl)c2o1 |
| InChI | InChI=1S/C19H13ClO5/c1-10-7-12(19(23)24)6-5-11(10)8-16(22)17-9-15(21)13-3-2-4-14(20)18(13)25-17/h2-7,9H,8H2,1H3,(H,23,24) |
| InChIKey | RDZUKYSQSYVEJL-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.76 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |