C23H22ClNO7 — CID 146487056
ethyl 2-[2-[4-[(8-chloro-4-oxochromene-2-carbonyl)amino]-3-methylphenoxy]ethoxy]acetate (PubChem CID 146487056) has the molecular formula C23H22ClNO7 and a molecular weight of 459.88 g/mol. Its IUPAC name is ethyl 2-[2-[4-[(8-chloro-4-oxochromene-2-carbonyl)amino]-3-methylphenoxy]ethoxy]acetate.
| Compound Name | ethyl 2-[2-[4-[(8-chloro-4-oxochromene-2-carbonyl)amino]-3-methylphenoxy]ethoxy]acetate |
|---|---|
| PubChem CID | 146487056 |
| Molecular Formula | C23H22ClNO7 |
| Molecular Weight | 459.88 g/mol |
| Exact Mass | 459.11 |
| IUPAC Name | ethyl 2-[2-[4-[(8-chloro-4-oxochromene-2-carbonyl)amino]-3-methylphenoxy]ethoxy]acetate |
| SMILES | CCOC(=O)COCCOc1ccc(NC(=O)c2cc(=O)c3cccc(Cl)c3o2)c(C)c1 |
| InChI | InChI=1S/C23H22ClNO7/c1-3-30-21(27)13-29-9-10-31-15-7-8-18(14(2)11-15)25-23(28)20-12-19(26)16-5-4-6-17(24)22(16)32-20/h4-8,11-12H,3,9-10,13H2,1-2H3,(H,25,28) |
| InChIKey | SMLARGSYOGPYEG-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.88 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|