C29H43N5OS — CID 167546390
[4-[6-[5-(diethylamino)-2-sulfanylidenepentyl]-4-methylquinolin-2-yl]piperazin-1-yl]-piperidin-2-ylmethanone (PubChem CID 167546390) has the molecular formula C29H43N5OS and a molecular weight of 509.76 g/mol. Its IUPAC name is [4-[6-[5-(diethylamino)-2-sulfanylidenepentyl]-4-methylquinolin-2-yl]piperazin-1-yl]-piperidin-2-ylmethanone.
| Compound Name | [4-[6-[5-(diethylamino)-2-sulfanylidenepentyl]-4-methylquinolin-2-yl]piperazin-1-yl]-piperidin-2-ylmethanone |
|---|---|
| PubChem CID | 167546390 |
| Molecular Formula | C29H43N5OS |
| Molecular Weight | 509.76 g/mol |
| Exact Mass | 509.32 |
| IUPAC Name | [4-[6-[5-(diethylamino)-2-sulfanylidenepentyl]-4-methylquinolin-2-yl]piperazin-1-yl]-piperidin-2-ylmethanone |
| SMILES | CCN(CC)CCCC(=S)Cc1ccc2nc(N3CCN(C(=O)C4CCCCN4)CC3)cc(C)c2c1 |
| InChI | InChI=1S/C29H43N5OS/c1-4-32(5-2)14-8-9-24(36)20-23-11-12-26-25(21-23)22(3)19-28(31-26)33-15-17-34(18-16-33)29(35)27-10-6-7-13-30-27/h11-12,19,21,27,30H,4-10,13-18,20H2,1-3H3 |
| InChIKey | BVQIDUQHKWTNKJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 51.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.76 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|