C29H43N7OS — CID 167710741
1-[2-(azepan-1-yl)ethyl]-3-[4-methyl-2-[4-(piperidine-2-carbonyl)piperazin-1-yl]quinolin-6-yl]thiourea (PubChem CID 167710741) has the molecular formula C29H43N7OS and a molecular weight of 537.78 g/mol. Its IUPAC name is 1-[2-(azepan-1-yl)ethyl]-3-[4-methyl-2-[4-(piperidine-2-carbonyl)piperazin-1-yl]quinolin-6-yl]thiourea.
| Compound Name | 1-[2-(azepan-1-yl)ethyl]-3-[4-methyl-2-[4-(piperidine-2-carbonyl)piperazin-1-yl]quinolin-6-yl]thiourea |
|---|---|
| PubChem CID | 167710741 |
| Molecular Formula | C29H43N7OS |
| Molecular Weight | 537.78 g/mol |
| Exact Mass | 537.32 |
| IUPAC Name | 1-[2-(azepan-1-yl)ethyl]-3-[4-methyl-2-[4-(piperidine-2-carbonyl)piperazin-1-yl]quinolin-6-yl]thiourea |
| SMILES | Cc1cc(N2CCN(C(=O)C3CCCCN3)CC2)nc2ccc(NC(=S)NCCN3CCCCCC3)cc12 |
| InChI | InChI=1S/C29H43N7OS/c1-22-20-27(35-16-18-36(19-17-35)28(37)26-8-4-5-11-30-26)33-25-10-9-23(21-24(22)25)32-29(38)31-12-15-34-13-6-2-3-7-14-34/h9-10,20-21,26,30H,2-8,11-19H2,1H3,(H2,31,32,38) |
| InChIKey | ZUMUWVCRROTQRS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 75.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|