C30H45N5S — CID 167710757
1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-5-[3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]pentane-2-thione (PubChem CID 167710757) has the molecular formula C30H45N5S and a molecular weight of 507.79 g/mol. Its IUPAC name is 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-5-[3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]pentane-2-thione.
| Compound Name | 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-5-[3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]pentane-2-thione |
|---|---|
| PubChem CID | 167710757 |
| Molecular Formula | C30H45N5S |
| Molecular Weight | 507.79 g/mol |
| Exact Mass | 507.34 |
| IUPAC Name | 1-[2-(4-ethylpiperazin-1-yl)-4-methylquinolin-6-yl]-5-[3-(pyrrolidin-1-ylmethyl)pyrrolidin-1-yl]pentane-2-thione |
| SMILES | CCN1CCN(c2cc(C)c3cc(CC(=S)CCCN4CCC(CN5CCCC5)C4)ccc3n2)CC1 |
| InChI | InChI=1S/C30H45N5S/c1-3-32-15-17-35(18-16-32)30-19-24(2)28-21-25(8-9-29(28)31-30)20-27(36)7-6-13-34-14-10-26(23-34)22-33-11-4-5-12-33/h8-9,19,21,26H,3-7,10-18,20,22-23H2,1-2H3 |
| InChIKey | ZUOIEMUDNPOLIL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 25.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.79 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|