C30H41N9O7S — CID 167546997
2-[(3S,6S,14S)-6-acetamido-14-[(3R)-3-(1,3-benzothiazole-2-carbonyl)-6-(diaminomethylideneamino)hexanoyl]-2,5,8-trioxo-1,4,9-triazacyclotetradec-3-yl]acetamide (PubChem CID 167546997) has the molecular formula C30H41N9O7S and a molecular weight of 671.78 g/mol. Its IUPAC name is 2-[(3S,6S,14S)-6-acetamido-14-[(3R)-3-(1,3-benzothiazole-2-carbonyl)-6-(diaminomethylideneamino)hexanoyl]-2,5,8-trioxo-1,4,9-triazacyclotetradec-3-yl]acetamide.
| Compound Name | 2-[(3S,6S,14S)-6-acetamido-14-[(3R)-3-(1,3-benzothiazole-2-carbonyl)-6-(diaminomethylideneamino)hexanoyl]-2,5,8-trioxo-1,4,9-triazacyclotetradec-3-yl]acetamide |
|---|---|
| PubChem CID | 167546997 |
| Molecular Formula | C30H41N9O7S |
| Molecular Weight | 671.78 g/mol |
| Exact Mass | 671.28 |
| IUPAC Name | 2-[(3S,6S,14S)-6-acetamido-14-[(3R)-3-(1,3-benzothiazole-2-carbonyl)-6-(diaminomethylideneamino)hexanoyl]-2,5,8-trioxo-1,4,9-triazacyclotetradec-3-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CC(=O)NCCCC[C@@H](C(=O)CC(CCCN=C(N)N)C(=O)c2nc3ccccc3s2)NC(=O)[C@H](CC(N)=O)NC1=O |
| InChI | InChI=1S/C30H41N9O7S/c1-16(40)36-21-15-25(43)34-11-5-4-8-18(37-27(45)20(14-24(31)42)38-28(21)46)22(41)13-17(7-6-12-35-30(32)33)26(44)29-39-19-9-2-3-10-23(19)47-29/h2-3,9-10,17-18,20-21H,4-8,11-15H2,1H3,(H2,31,42)(H,34,43)(H,36,40)(H,37,45)(H,38,46)(H4,32,33,35)/t17?,18-,20-,21-/m0/s1 |
| InChIKey | BXNZKXOKHVSOAR-AFUJVPCRSA-N |
| XLogP | -0.85 |
| TPSA | 270.92 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.78 |
| LogP ≤ 5 | -0.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|