C30H40N6O6S — CID 167620918
N-[(6S,14S)-14-[(3R)-6-(1-aminoethylideneamino)-3-(1,3-benzothiazole-2-carbonyl)hexanoyl]-2,5,8-trioxo-1,4-diazacyclotetradec-6-yl]acetamide (PubChem CID 167620918) has the molecular formula C30H40N6O6S and a molecular weight of 612.75 g/mol. Its IUPAC name is N-[(6S,14S)-14-[(3R)-6-(1-aminoethylideneamino)-3-(1,3-benzothiazole-2-carbonyl)hexanoyl]-2,5,8-trioxo-1,4-diazacyclotetradec-6-yl]acetamide.
| Compound Name | N-[(6S,14S)-14-[(3R)-6-(1-aminoethylideneamino)-3-(1,3-benzothiazole-2-carbonyl)hexanoyl]-2,5,8-trioxo-1,4-diazacyclotetradec-6-yl]acetamide |
|---|---|
| PubChem CID | 167620918 |
| Molecular Formula | C30H40N6O6S |
| Molecular Weight | 612.75 g/mol |
| Exact Mass | 612.27 |
| IUPAC Name | N-[(6S,14S)-14-[(3R)-6-(1-aminoethylideneamino)-3-(1,3-benzothiazole-2-carbonyl)hexanoyl]-2,5,8-trioxo-1,4-diazacyclotetradec-6-yl]acetamide |
| SMILES | CC(=O)N[C@H]1CC(=O)CCCCC[C@@H](C(=O)C[C@@H](CCC/N=C(\C)N)C(=O)c2nc3ccccc3s2)NC(=O)CNC1=O |
| InChI | InChI=1S/C30H40N6O6S/c1-18(31)32-14-8-9-20(28(41)30-36-23-12-6-7-13-26(23)43-30)15-25(39)22-11-5-3-4-10-21(38)16-24(34-19(2)37)29(42)33-17-27(40)35-22/h6-7,12-13,20,22,24H,3-5,8-11,14-17H2,1-2H3,(H2,31,32)(H,33,42)(H,34,37)(H,35,40)/t20-,22+,24+/m1/s1 |
| InChIKey | GPSXTIXQNAYVEV-SFLYRZDNSA-N |
| XLogP | 2.24 |
| TPSA | 189.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.75 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|