C29H35N7O3S — CID 59627564
2-[6-[(3S,6R)-6-amino-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-3-yl]-4-(1,3-benzothiazole-2-carbonyl)-6-oxohexyl]guanidine (PubChem CID 59627564) has the molecular formula C29H35N7O3S and a molecular weight of 561.71 g/mol. Its IUPAC name is 2-[6-[(3S,6R)-6-amino-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-3-yl]-4-(1,3-benzothiazole-2-carbonyl)-6-oxohexyl]guanidine.
| Compound Name | 2-[6-[(3S,6R)-6-amino-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-3-yl]-4-(1,3-benzothiazole-2-carbonyl)-6-oxohexyl]guanidine |
|---|---|
| PubChem CID | 59627564 |
| Molecular Formula | C29H35N7O3S |
| Molecular Weight | 561.71 g/mol |
| Exact Mass | 561.25 |
| IUPAC Name | 2-[6-[(3S,6R)-6-amino-6-benzyl-5-oxo-2,3,7,8-tetrahydro-1H-pyrazolo[1,2-a]pyridazin-3-yl]-4-(1,3-benzothiazole-2-carbonyl)-6-oxohexyl]guanidine |
| SMILES | NC(N)=NCCCC(CC(=O)[C@@H]1CCN2CC[C@](N)(Cc3ccccc3)C(=O)N12)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C29H35N7O3S/c30-28(31)33-14-6-9-20(25(38)26-34-21-10-4-5-11-24(21)40-26)17-23(37)22-12-15-35-16-13-29(32,27(39)36(22)35)18-19-7-2-1-3-8-19/h1-5,7-8,10-11,20,22H,6,9,12-18,32H2,(H4,30,31,33)/t20?,22-,29-/m0/s1 |
| InChIKey | REUWIOAHFAXBBP-GMLCIZHSSA-N |
| XLogP | 2.27 |
| TPSA | 161.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.71 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|