C27H33N7O3S — CID 67568170
(2S)-N-[(2S)-2-amino-3-phenylpropanoyl]-1-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide (PubChem CID 67568170) has the molecular formula C27H33N7O3S and a molecular weight of 535.67 g/mol. Its IUPAC name is (2S)-N-[(2S)-2-amino-3-phenylpropanoyl]-1-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2S)-2-amino-3-phenylpropanoyl]-1-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 67568170 |
| Molecular Formula | C27H33N7O3S |
| Molecular Weight | 535.67 g/mol |
| Exact Mass | 535.24 |
| IUPAC Name | (2S)-N-[(2S)-2-amino-3-phenylpropanoyl]-1-[1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]pyrrolidine-2-carboxamide |
| SMILES | NC(N)=NCCCC(C(=O)c1nc2ccccc2s1)N1CCC[C@H]1C(=O)NC(=O)[C@@H](N)Cc1ccccc1 |
| InChI | InChI=1S/C27H33N7O3S/c28-18(16-17-8-2-1-3-9-17)24(36)33-25(37)21-12-7-15-34(21)20(11-6-14-31-27(29)30)23(35)26-32-19-10-4-5-13-22(19)38-26/h1-5,8-10,13,18,20-21H,6-7,11-12,14-16,28H2,(H4,29,30,31)(H,33,36,37)/t18-,20?,21-/m0/s1 |
| InChIKey | NXZQUAHCNJMMIC-QJQMAANRSA-N |
| XLogP | 1.58 |
| TPSA | 169.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.67 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|