C28H37N7O2S — CID 11376076
(2S)-N-[(2R)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)pentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide (PubChem CID 11376076) has the molecular formula C28H37N7O2S and a molecular weight of 535.72 g/mol. Its IUPAC name is (2S)-N-[(2R)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)pentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide.
| Compound Name | (2S)-N-[(2R)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)pentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 11376076 |
| Molecular Formula | C28H37N7O2S |
| Molecular Weight | 535.72 g/mol |
| Exact Mass | 535.27 |
| IUPAC Name | (2S)-N-[(2R)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)pentan-2-yl]-1-[(2R)-2-(methylamino)-3-phenylpropanoyl]pyrrolidine-2-carboxamide |
| SMILES | CN[C@H](Cc1ccccc1)C(=O)N1CCC[C@H]1C(=O)N[C@H](CCCN=C(N)N)Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C28H37N7O2S/c1-31-22(17-19-9-3-2-4-10-19)27(37)35-16-8-13-23(35)26(36)33-20(11-7-15-32-28(29)30)18-25-34-21-12-5-6-14-24(21)38-25/h2-6,9-10,12,14,20,22-23,31H,7-8,11,13,15-18H2,1H3,(H,33,36)(H4,29,30,32)/t20-,22-,23+/m1/s1 |
| InChIKey | WQCJFMKHZOFRAR-MZYLBHOOSA-N |
| XLogP | 2.20 |
| TPSA | 138.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.72 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|