C19H25ClN2 — CID 167555712
2-chloro-5-[3-[1-(4-methylphenyl)propan-2-ylamino]propyl]aniline (PubChem CID 167555712) has the molecular formula C19H25ClN2 and a molecular weight of 316.88 g/mol. Its IUPAC name is 2-chloro-5-[3-[1-(4-methylphenyl)propan-2-ylamino]propyl]aniline.
| Compound Name | 2-chloro-5-[3-[1-(4-methylphenyl)propan-2-ylamino]propyl]aniline |
|---|---|
| PubChem CID | 167555712 |
| Molecular Formula | C19H25ClN2 |
| Molecular Weight | 316.88 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 2-chloro-5-[3-[1-(4-methylphenyl)propan-2-ylamino]propyl]aniline |
| SMILES | Cc1ccc(CC(C)NCCCc2ccc(Cl)c(N)c2)cc1 |
| InChI | InChI=1S/C19H25ClN2/c1-14-5-7-17(8-6-14)12-15(2)22-11-3-4-16-9-10-18(20)19(21)13-16/h5-10,13,15,22H,3-4,11-12,21H2,1-2H3 |
| InChIKey | YWIJRXPRODTUNV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.88 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|