C16H22N4O4S — CID 167555837
benzyl 5-[(1-methylpyrazol-4-yl)-sulfamoylamino]pentanoate (PubChem CID 167555837) has the molecular formula C16H22N4O4S and a molecular weight of 366.44 g/mol. Its IUPAC name is benzyl 5-[(1-methylpyrazol-4-yl)-sulfamoylamino]pentanoate.
| Compound Name | benzyl 5-[(1-methylpyrazol-4-yl)-sulfamoylamino]pentanoate |
|---|---|
| PubChem CID | 167555837 |
| Molecular Formula | C16H22N4O4S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | benzyl 5-[(1-methylpyrazol-4-yl)-sulfamoylamino]pentanoate |
| SMILES | Cn1cc(N(CCCCC(=O)OCc2ccccc2)S(N)(=O)=O)cn1 |
| InChI | InChI=1S/C16H22N4O4S/c1-19-12-15(11-18-19)20(25(17,22)23)10-6-5-9-16(21)24-13-14-7-3-2-4-8-14/h2-4,7-8,11-12H,5-6,9-10,13H2,1H3,(H2,17,22,23) |
| InChIKey | JVOQQHJDSUWWQB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 107.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|