C10H14Br2N2O5 — CID 167555895
3-[2-[[(Z)-2,3-dibromo-4-(methylamino)-4-oxobut-2-enoyl]amino]ethoxy]propanoic acid (PubChem CID 167555895) has the molecular formula C10H14Br2N2O5 and a molecular weight of 402.04 g/mol. Its IUPAC name is 3-[2-[[(Z)-2,3-dibromo-4-(methylamino)-4-oxobut-2-enoyl]amino]ethoxy]propanoic acid.
| Compound Name | 3-[2-[[(Z)-2,3-dibromo-4-(methylamino)-4-oxobut-2-enoyl]amino]ethoxy]propanoic acid |
|---|---|
| PubChem CID | 167555895 |
| Molecular Formula | C10H14Br2N2O5 |
| Molecular Weight | 402.04 g/mol |
| Exact Mass | 399.93 |
| IUPAC Name | 3-[2-[[(Z)-2,3-dibromo-4-(methylamino)-4-oxobut-2-enoyl]amino]ethoxy]propanoic acid |
| SMILES | CNC(=O)/C(Br)=C(/Br)C(=O)NCCOCCC(=O)O |
| InChI | InChI=1S/C10H14Br2N2O5/c1-13-9(17)7(11)8(12)10(18)14-3-5-19-4-2-6(15)16/h2-5H2,1H3,(H,13,17)(H,14,18)(H,15,16)/b8-7- |
| InChIKey | HMUWZORIJLXVQZ-FPLPWBNLSA-N |
| XLogP | 0.34 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.04 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|