C13H19Br2NO6 — CID 162482788
(Z)-2,3-dibromo-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethylamino]-4-oxobut-2-enoic acid (PubChem CID 162482788) has the molecular formula C13H19Br2NO6 and a molecular weight of 445.10 g/mol. Its IUPAC name is (Z)-2,3-dibromo-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (Z)-2,3-dibromo-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 162482788 |
| Molecular Formula | C13H19Br2NO6 |
| Molecular Weight | 445.10 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | (Z)-2,3-dibromo-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethylamino]-4-oxobut-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)CCOCCNC(=O)/C(Br)=C(/Br)C(=O)O |
| InChI | InChI=1S/C13H19Br2NO6/c1-13(2,3)22-8(17)4-6-21-7-5-16-11(18)9(14)10(15)12(19)20/h4-7H2,1-3H3,(H,16,18)(H,19,20)/b10-9- |
| InChIKey | VGOWPIKEJLDWRY-KTKRTIGZSA-N |
| XLogP | 1.94 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.10 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|