C13H20BrNO6 — CID 162482803
(E)-3-bromo-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethylamino]-4-oxobut-2-enoic acid (PubChem CID 162482803) has the molecular formula C13H20BrNO6 and a molecular weight of 366.21 g/mol. Its IUPAC name is (E)-3-bromo-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethylamino]-4-oxobut-2-enoic acid.
| Compound Name | (E)-3-bromo-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethylamino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 162482803 |
| Molecular Formula | C13H20BrNO6 |
| Molecular Weight | 366.21 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | (E)-3-bromo-4-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethylamino]-4-oxobut-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)CCOCCNC(=O)/C(Br)=C\C(=O)O |
| InChI | InChI=1S/C13H20BrNO6/c1-13(2,3)21-11(18)4-6-20-7-5-15-12(19)9(14)8-10(16)17/h8H,4-7H2,1-3H3,(H,15,19)(H,16,17)/b9-8+ |
| InChIKey | CMTMMDOIDCKJMQ-CMDGGOBGSA-N |
| XLogP | 1.21 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.21 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|