C16H25BrO7 — CID 161138506
(E)-2-bromo-7-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]-4-oxohept-2-enoic acid (PubChem CID 161138506) has the molecular formula C16H25BrO7 and a molecular weight of 409.27 g/mol. Its IUPAC name is (E)-2-bromo-7-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]-4-oxohept-2-enoic acid.
| Compound Name | (E)-2-bromo-7-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]-4-oxohept-2-enoic acid |
|---|---|
| PubChem CID | 161138506 |
| Molecular Formula | C16H25BrO7 |
| Molecular Weight | 409.27 g/mol |
| Exact Mass | 408.08 |
| IUPAC Name | (E)-2-bromo-7-[2-[3-[(2-methylpropan-2-yl)oxy]-3-oxopropoxy]ethoxy]-4-oxohept-2-enoic acid |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCCC(=O)/C=C(/Br)C(=O)O |
| InChI | InChI=1S/C16H25BrO7/c1-16(2,3)24-14(19)6-8-23-10-9-22-7-4-5-12(18)11-13(17)15(20)21/h11H,4-10H2,1-3H3,(H,20,21)/b13-11+ |
| InChIKey | UNCSXXOFFSKMPB-ACCUITESSA-N |
| XLogP | 2.46 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.27 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|