About 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid
5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid (PubChem CID 167565849) has the molecular formula C17H14N2O3
and a molecular weight of 294.31 g/mol. Its IUPAC name is 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid.
Molecular Properties
| Compound Name | 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid |
| PubChem CID | 167565849 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid |
| SMILES | Cc1ccc(-c2coc(Cc3ccc(C(=O)O)nc3)n2)cc1 |
| InChI | InChI=1S/C17H14N2O3/c1-11-2-5-13(6-3-11)15-10-22-16(19-15)8-12-4-7-14(17(20)21)18-9-12/h2-7,9-10H,8H2,1H3,(H,20,21) |
| InChIKey | HWQLLSRNHQFQNG-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid?
The IUPAC name of 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid (CID 167565849) is 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid.
What is the SMILES notation for 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid?
The canonical SMILES for 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid is Cc1ccc(-c2coc(Cc3ccc(C(=O)O)nc3)n2)cc1.
What is the InChIKey of 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid?
The InChIKey is HWQLLSRNHQFQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3/c1-11-2-5-13(6-3-11)15-10-22-16(19-15)8-12-4-7-14(17(20)21)18-9-12/h2-7,9-10H,8H2,1H3,(H,20,21).
What are the key properties of 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid?
5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid has a molecular weight of 294.31 g/mol, XLogP of 3.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-(4-methylphenyl)-1,3-oxazol-2-yl]methyl]pyridine-2-carboxylic acid is sourced from PubChem (CID 167565849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).