C11H20B2O6P2 — CID 167567384
[(3aR,5R,6S,6aR)-2,2-dimethyl-6-[methyl(phosphoroso)boranyl]-5-[[methyl(phosphoroso)boranyl]methyl]-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol (PubChem CID 167567384) has the molecular formula C11H20B2O6P2 and a molecular weight of 331.85 g/mol. Its IUPAC name is [(3aR,5R,6S,6aR)-2,2-dimethyl-6-[methyl(phosphoroso)boranyl]-5-[[methyl(phosphoroso)boranyl]methyl]-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol.
| Compound Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-6-[methyl(phosphoroso)boranyl]-5-[[methyl(phosphoroso)boranyl]methyl]-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol |
|---|---|
| PubChem CID | 167567384 |
| Molecular Formula | C11H20B2O6P2 |
| Molecular Weight | 331.85 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | [(3aR,5R,6S,6aR)-2,2-dimethyl-6-[methyl(phosphoroso)boranyl]-5-[[methyl(phosphoroso)boranyl]methyl]-6,6a-dihydro-3aH-furo[2,3-d][1,3]dioxol-5-yl]methanol |
| SMILES | CB(C[C@@]1(CO)O[C@@H]2OC(C)(C)O[C@@H]2[C@@H]1B(C)P=O)P=O |
| InChI | InChI=1S/C11H20B2O6P2/c1-10(2)17-7-8(13(4)21-16)11(6-14,5-12(3)20-15)19-9(7)18-10/h7-9,14H,5-6H2,1-4H3/t7-,8+,9+,11+/m1/s1 |
| InChIKey | PBIOJGPNBRFLFM-HJGDQZAQSA-N |
| XLogP | 2.42 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.85 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|