C13H22O4 — CID 16757303
ethyl (2E,4R)-4-(dimethoxymethyl)-3-methylhepta-2,6-dienoate (PubChem CID 16757303) has the molecular formula C13H22O4 and a molecular weight of 242.31 g/mol. Its IUPAC name is ethyl (2E,4R)-4-(dimethoxymethyl)-3-methylhepta-2,6-dienoate.
| Compound Name | ethyl (2E,4R)-4-(dimethoxymethyl)-3-methylhepta-2,6-dienoate |
|---|---|
| PubChem CID | 16757303 |
| Molecular Formula | C13H22O4 |
| Molecular Weight | 242.31 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | ethyl (2E,4R)-4-(dimethoxymethyl)-3-methylhepta-2,6-dienoate |
| SMILES | C=CC[C@H](/C(C)=C/C(=O)OCC)C(OC)OC |
| InChI | InChI=1S/C13H22O4/c1-6-8-11(13(15-4)16-5)10(3)9-12(14)17-7-2/h6,9,11,13H,1,7-8H2,2-5H3/b10-9+/t11-/m1/s1 |
| InChIKey | MNXFDIJJBNVBHC-PBQZMEPESA-N |
| XLogP | 2.31 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.31 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|